C21H22N4O4 — CID 42143602
2,3-dimethoxy-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzamide (PubChem CID 42143602) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 42143602 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2,3-dimethoxy-N-[3-(6-oxo-3-pyridin-3-ylpyridazin-1-yl)propyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCCn2nc(-c3cccnc3)ccc2=O)c1OC |
| InChI | InChI=1S/C21H22N4O4/c1-28-18-8-3-7-16(20(18)29-2)21(27)23-12-5-13-25-19(26)10-9-17(24-25)15-6-4-11-22-14-15/h3-4,6-11,14H,5,12-13H2,1-2H3,(H,23,27) |
| InChIKey | OTIHRHREFMADSV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|