C13H16ClN2O5S- — CID 4218611
4-chloro-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate (PubChem CID 4218611) has the molecular formula C13H16ClN2O5S- and a molecular weight of 347.80 g/mol. Its IUPAC name is 4-chloro-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate.
| Compound Name | 4-chloro-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
|---|---|
| PubChem CID | 4218611 |
| Molecular Formula | C13H16ClN2O5S- |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-chloro-5-(dimethylsulfamoyl)-2-morpholin-4-ylbenzoate |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)[O-])c(N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O5S/c1-15(2)22(19,20)12-7-9(13(17)18)11(8-10(12)14)16-3-5-21-6-4-16/h7-8H,3-6H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | GBGKMISELOQFCM-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |