C13H10ClN5O — CID 4224953
3-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazol-5-amine (PubChem CID 4224953) has the molecular formula C13H10ClN5O and a molecular weight of 287.71 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 4224953 |
| Molecular Formula | C13H10ClN5O |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)furan-2-yl]methylideneamino]-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(N=Cc2ccc(-c3cccc(Cl)c3)o2)n[nH]1 |
| InChI | InChI=1S/C13H10ClN5O/c14-9-3-1-2-8(6-9)11-5-4-10(20-11)7-16-13-17-12(15)18-19-13/h1-7H,(H3,15,17,18,19) |
| InChIKey | QNCBANUMUONSAC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|