C17H20ClN3O2 — CID 42439712
1-(5-chloro-3-methyl-1H-indole-2-carbonyl)-4-ethyl-1,4-diazepan-5-one (PubChem CID 42439712) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 1-(5-chloro-3-methyl-1H-indole-2-carbonyl)-4-ethyl-1,4-diazepan-5-one.
| Compound Name | 1-(5-chloro-3-methyl-1H-indole-2-carbonyl)-4-ethyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42439712 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-(5-chloro-3-methyl-1H-indole-2-carbonyl)-4-ethyl-1,4-diazepan-5-one |
| SMILES | CCN1CCN(C(=O)c2[nH]c3ccc(Cl)cc3c2C)CCC1=O |
| InChI | InChI=1S/C17H20ClN3O2/c1-3-20-8-9-21(7-6-15(20)22)17(23)16-11(2)13-10-12(18)4-5-14(13)19-16/h4-5,10,19H,3,6-9H2,1-2H3 |
| InChIKey | VTSGWPYHKDZKPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|