C28H34FN3O4 — CID 42467784
N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]pent-4-enamide (PubChem CID 42467784) has the molecular formula C28H34FN3O4 and a molecular weight of 495.60 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]pent-4-enamide.
| Compound Name | N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]pent-4-enamide |
|---|---|
| PubChem CID | 42467784 |
| Molecular Formula | C28H34FN3O4 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-[[2-(dimethylamino)-5,6,7-trimethoxyquinolin-3-yl]methyl]-N-[2-(4-fluorophenyl)ethyl]pent-4-enamide |
| SMILES | C=CCCC(=O)N(CCc1ccc(F)cc1)Cc1cc2c(OC)c(OC)c(OC)cc2nc1N(C)C |
| InChI | InChI=1S/C28H34FN3O4/c1-7-8-9-25(33)32(15-14-19-10-12-21(29)13-11-19)18-20-16-22-23(30-28(20)31(2)3)17-24(34-4)27(36-6)26(22)35-5/h7,10-13,16-17H,1,8-9,14-15,18H2,2-6H3 |
| InChIKey | XPPMKQPBDIIMIR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|