C22H18BrCl2NO3 — CID 42550417
(2R,3Z)-1-(5-bromo-6-methoxynaphthalen-2-yl)-3-[(2,4-dichlorophenyl)methoxyimino]-2-methylpropan-1-one (PubChem CID 42550417) has the molecular formula C22H18BrCl2NO3 and a molecular weight of 495.20 g/mol. Its IUPAC name is (2R,3Z)-1-(5-bromo-6-methoxynaphthalen-2-yl)-3-[(2,4-dichlorophenyl)methoxyimino]-2-methylpropan-1-one.
| Compound Name | (2R,3Z)-1-(5-bromo-6-methoxynaphthalen-2-yl)-3-[(2,4-dichlorophenyl)methoxyimino]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 42550417 |
| Molecular Formula | C22H18BrCl2NO3 |
| Molecular Weight | 495.20 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | (2R,3Z)-1-(5-bromo-6-methoxynaphthalen-2-yl)-3-[(2,4-dichlorophenyl)methoxyimino]-2-methylpropan-1-one |
| SMILES | COc1ccc2cc(C(=O)[C@H](C)/C=N\OCc3ccc(Cl)cc3Cl)ccc2c1Br |
| InChI | InChI=1S/C22H18BrCl2NO3/c1-13(11-26-29-12-16-3-6-17(24)10-19(16)25)22(27)15-4-7-18-14(9-15)5-8-20(28-2)21(18)23/h3-11,13H,12H2,1-2H3/b26-11-/t13-/m1/s1 |
| InChIKey | IMZCQQOLZCPSHC-HIWDBDMKSA-N |
| XLogP | 6.94 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.20 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|