C17H13BrN4O2S2 — CID 42568780
4-[(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-2,1,3-benzothiadiazole (PubChem CID 42568780) has the molecular formula C17H13BrN4O2S2 and a molecular weight of 449.36 g/mol. Its IUPAC name is 4-[(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-2,1,3-benzothiadiazole.
| Compound Name | 4-[(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 42568780 |
| Molecular Formula | C17H13BrN4O2S2 |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 4-[(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-2,1,3-benzothiadiazole |
| SMILES | O=S(=O)(c1cccc2nsnc12)N1CCc2[nH]c3c(Br)cccc3c2C1 |
| InChI | InChI=1S/C17H13BrN4O2S2/c18-12-4-1-3-10-11-9-22(8-7-13(11)19-16(10)12)26(23,24)15-6-2-5-14-17(15)21-25-20-14/h1-6,19H,7-9H2 |
| InChIKey | YVFHTXTYNJMNRO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|