C23H31NO3 — CID 42576424
N-(1-adamantylmethyl)-3-methoxy-N-methyl-4-prop-2-enoxybenzamide (PubChem CID 42576424) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-methoxy-N-methyl-4-prop-2-enoxybenzamide.
| Compound Name | N-(1-adamantylmethyl)-3-methoxy-N-methyl-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 42576424 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-(1-adamantylmethyl)-3-methoxy-N-methyl-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N(C)CC23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C23H31NO3/c1-4-7-27-20-6-5-19(11-21(20)26-3)22(25)24(2)15-23-12-16-8-17(13-23)10-18(9-16)14-23/h4-6,11,16-18H,1,7-10,12-15H2,2-3H3 |
| InChIKey | KJMSACKSQDTJNN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|