C35H47F3O8SSi — CID 42598224
[(2R,3S)-2-[(2R)-4-[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-yl]-3-ethyl-6-oxo-2,3-dihydropyran-4-yl] trifluoromethanesulfonate (PubChem CID 42598224) has the molecular formula C35H47F3O8SSi and a molecular weight of 712.90 g/mol. Its IUPAC name is [(2R,3S)-2-[(2R)-4-[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-yl]-3-ethyl-6-oxo-2,3-dihydropyran-4-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3S)-2-[(2R)-4-[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-yl]-3-ethyl-6-oxo-2,3-dihydropyran-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 42598224 |
| Molecular Formula | C35H47F3O8SSi |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | [(2R,3S)-2-[(2R)-4-[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-yl]-3-ethyl-6-oxo-2,3-dihydropyran-4-yl] trifluoromethanesulfonate |
| SMILES | CC[C@@H]1C(OS(=O)(=O)C(F)(F)F)=CC(=O)O[C@@H]1[C@H](C)CC[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C35H47F3O8SSi/c1-8-29-30(46-47(40,41)35(36,37)38)22-31(39)43-32(29)24(2)19-20-25-21-26(45-34(6,7)44-25)23-42-48(33(3,4)5,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,22,24-26,29,32H,8,19-21,23H2,1-7H3/t24-,25-,26+,29-,32-/m1/s1 |
| InChIKey | PJUAAXXUGWWRFJ-DQOWHOEFSA-N |
| XLogP | 6.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|