C8H15N2NaO6S3 — CID 42600305
sodium 2-[[(3S)-3-[(2-aminoacetyl)amino]-3-carboxypropyl]disulfanyl]ethanesulfonate (PubChem CID 42600305) has the molecular formula C8H15N2NaO6S3 and a molecular weight of 354.41 g/mol. Its IUPAC name is sodium 2-[[(3S)-3-[(2-aminoacetyl)amino]-3-carboxypropyl]disulfanyl]ethanesulfonate.
| Compound Name | sodium 2-[[(3S)-3-[(2-aminoacetyl)amino]-3-carboxypropyl]disulfanyl]ethanesulfonate |
|---|---|
| PubChem CID | 42600305 |
| Molecular Formula | C8H15N2NaO6S3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | sodium 2-[[(3S)-3-[(2-aminoacetyl)amino]-3-carboxypropyl]disulfanyl]ethanesulfonate |
| SMILES | NCC(=O)N[C@@H](CCSSCCS(=O)(=O)[O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C8H16N2O6S3.Na/c9-5-7(11)10-6(8(12)13)1-2-17-18-3-4-19(14,15)16;/h6H,1-5,9H2,(H,10,11)(H,12,13)(H,14,15,16);/q;+1/p-1/t6-;/m0./s1 |
| InChIKey | WVCAARAJBLRWDS-RGMNGODLSA-M |
| XLogP | -4.16 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|