C16H20ClN3O2S — CID 42606475
N-(3-aminopropyl)-5-oxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-9-carboxamide;hydrochloride (PubChem CID 42606475) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-oxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-9-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-5-oxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 42606475 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(3-aminopropyl)-5-oxo-1,2,4,6-tetrahydrothiopyrano[3,4-c]quinoline-9-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1ccc2[nH]c(=O)c3c(c2c1)CCSC3 |
| InChI | InChI=1S/C16H19N3O2S.ClH/c17-5-1-6-18-15(20)10-2-3-14-12(8-10)11-4-7-22-9-13(11)16(21)19-14;/h2-3,8H,1,4-7,9,17H2,(H,18,20)(H,19,21);1H |
| InChIKey | RBFLJALCQJCMAC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|