C25H46O — CID 42608271
2,6,14-Trimethyl-6,7-epoxy-10-methylene-9-(3-methylpent-4-enyl)-pentadecane (PubChem CID 42608271) has the molecular formula C25H46O and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-methyl-3-[7-methyl-3-methylidene-2-(3-methylpent-4-enyl)octyl]-2-(4-methylpentyl)oxirane.
| Compound Name | 2,6,14-Trimethyl-6,7-epoxy-10-methylene-9-(3-methylpent-4-enyl)-pentadecane |
|---|---|
| PubChem CID | 42608271 |
| Molecular Formula | C25H46O |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | 2-methyl-3-[7-methyl-3-methylidene-2-(3-methylpent-4-enyl)octyl]-2-(4-methylpentyl)oxirane |
| SMILES | CC(C)CCCC(=C)C(CCC(C)C=C)CC1C(O1)(C)CCCC(C)C |
| InChI | InChI=1S/C25H46O/c1-9-21(6)15-16-23(22(7)14-10-12-19(2)3)18-24-25(8,26-24)17-11-13-20(4)5/h9,19-21,23-24H,1,7,10-18H2,2-6,8H3 |
| InChIKey | YOCDPWQZFQLBCY-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | 422 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|