C22H36O3Si — CID 42611999
[1-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]-4,4-dimethylhept-6-en-1-yn-3-yl] acetate (PubChem CID 42611999) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is [1-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]-4,4-dimethylhept-6-en-1-yn-3-yl] acetate.
| Compound Name | [1-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]-4,4-dimethylhept-6-en-1-yn-3-yl] acetate |
|---|---|
| PubChem CID | 42611999 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [1-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]-4,4-dimethylhept-6-en-1-yn-3-yl] acetate |
| SMILES | C=CCC(C)(C)C(C#CC1=CC(O[Si](C)(C)C(C)(C)C)CC1)OC(C)=O |
| InChI | InChI=1S/C22H36O3Si/c1-10-15-22(6,7)20(24-17(2)23)14-12-18-11-13-19(16-18)25-26(8,9)21(3,4)5/h10,16,19-20H,1,11,13,15H2,2-9H3 |
| InChIKey | ZKSWKSQJLLHXKJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|