C21H20O2Si — CID 42618311
(2E,4E,6Z)-5-methoxy-2-trimethylsilyltricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaen-8-yn-17-one (PubChem CID 42618311) has the molecular formula C21H20O2Si and a molecular weight of 332.48 g/mol. Its IUPAC name is (2E,4E,6Z)-5-methoxy-2-trimethylsilyltricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaen-8-yn-17-one.
| Compound Name | (2E,4E,6Z)-5-methoxy-2-trimethylsilyltricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaen-8-yn-17-one |
|---|---|
| PubChem CID | 42618311 |
| Molecular Formula | C21H20O2Si |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2E,4E,6Z)-5-methoxy-2-trimethylsilyltricyclo[8.7.0.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaen-8-yn-17-one |
| SMILES | COc1ccc#cc2c(c([Si](C)(C)C)cc1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H20O2Si/c1-23-15-9-5-6-11-17-16-10-7-8-12-18(16)21(22)20(17)19(14-13-15)24(2,3)4/h5,7-10,12-14H,1-4H3/b9-5-,14-13-,15-9+,15-13+,19-14+,20-19- |
| InChIKey | SMBHCLKORNUVFK-YCXKGNRDSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|