C15H11N3O — CID 42638357
3-methyl-6H-imidazo[4,5-a]acridin-11-one (PubChem CID 42638357) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-methyl-6H-imidazo[4,5-a]acridin-11-one.
| Compound Name | 3-methyl-6H-imidazo[4,5-a]acridin-11-one |
|---|---|
| PubChem CID | 42638357 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-methyl-6H-imidazo[4,5-a]acridin-11-one |
| SMILES | Cn1cnc2c3c(=O)c4ccccc4[nH]c3ccc21 |
| InChI | InChI=1S/C15H11N3O/c1-18-8-16-14-12(18)7-6-11-13(14)15(19)9-4-2-3-5-10(9)17-11/h2-8H,1H3,(H,17,19) |
| InChIKey | FCBIYLBVAPPKPX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|