C16H12N2O — CID 10562509
1-methyl-6H-pyrrolo[2,3-a]acridin-11-one (PubChem CID 10562509) has the molecular formula C16H12N2O and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-methyl-6H-pyrrolo[2,3-a]acridin-11-one.
| Compound Name | 1-methyl-6H-pyrrolo[2,3-a]acridin-11-one |
|---|---|
| PubChem CID | 10562509 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-methyl-6H-pyrrolo[2,3-a]acridin-11-one |
| SMILES | Cn1ccc2ccc3[nH]c4ccccc4c(=O)c3c21 |
| InChI | InChI=1S/C16H12N2O/c1-18-9-8-10-6-7-13-14(15(10)18)16(19)11-4-2-3-5-12(11)17-13/h2-9H,1H3,(H,17,19) |
| InChIKey | RIKWFUUFEFLEFZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|