C24H34N4O — CID 42646272
N-[3-(2-methoxy-7-methyl-7-phenyl-3,4,6,8,9,9a-hexahydro-1H-quinolizin-2-yl)propyl]pyrimidin-2-amine (PubChem CID 42646272) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[3-(2-methoxy-7-methyl-7-phenyl-3,4,6,8,9,9a-hexahydro-1H-quinolizin-2-yl)propyl]pyrimidin-2-amine.
| Compound Name | N-[3-(2-methoxy-7-methyl-7-phenyl-3,4,6,8,9,9a-hexahydro-1H-quinolizin-2-yl)propyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 42646272 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-[3-(2-methoxy-7-methyl-7-phenyl-3,4,6,8,9,9a-hexahydro-1H-quinolizin-2-yl)propyl]pyrimidin-2-amine |
| SMILES | COC1(CCCNc2ncccn2)CCN2CC(C)(c3ccccc3)CCC2C1 |
| InChI | InChI=1S/C24H34N4O/c1-23(20-8-4-3-5-9-20)12-10-21-18-24(29-2,13-17-28(21)19-23)11-6-14-25-22-26-15-7-16-27-22/h3-5,7-9,15-16,21H,6,10-14,17-19H2,1-2H3,(H,25,26,27) |
| InChIKey | PTYYVVXUGBTWIC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|