C10H10ClN3O2 — CID 42647724
6-chloro-4-morpholin-4-yl-2,1,3-benzoxadiazole (PubChem CID 42647724) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 6-chloro-4-morpholin-4-yl-2,1,3-benzoxadiazole.
| Compound Name | 6-chloro-4-morpholin-4-yl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 42647724 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 6-chloro-4-morpholin-4-yl-2,1,3-benzoxadiazole |
| SMILES | Clc1cc(N2CCOCC2)c2nonc2c1 |
| InChI | InChI=1S/C10H10ClN3O2/c11-7-5-8-10(13-16-12-8)9(6-7)14-1-3-15-4-2-14/h5-6H,1-4H2 |
| InChIKey | JMSLBXGCRGVPAC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_B(3)', 'substructure': 'N/A'} |
|---|