C12H11N3O2 — CID 51138608
6-ethynyl-4-morpholin-4-yl-2,1,3-benzoxadiazole (PubChem CID 51138608) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 6-ethynyl-4-morpholin-4-yl-2,1,3-benzoxadiazole.
| Compound Name | 6-ethynyl-4-morpholin-4-yl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 51138608 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 6-ethynyl-4-morpholin-4-yl-2,1,3-benzoxadiazole |
| SMILES | C#Cc1cc(N2CCOCC2)c2nonc2c1 |
| InChI | InChI=1S/C12H11N3O2/c1-2-9-7-10-12(14-17-13-10)11(8-9)15-3-5-16-6-4-15/h1,7-8H,3-6H2 |
| InChIKey | SWVZCRNKUNBPLX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|