C19H25NO3S — CID 42729198
propan-2-yl 3-[(E)-3-phenylprop-2-enoyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylate (PubChem CID 42729198) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is propan-2-yl 3-[(E)-3-phenylprop-2-enoyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylate.
| Compound Name | propan-2-yl 3-[(E)-3-phenylprop-2-enoyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729198 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | propan-2-yl 3-[(E)-3-phenylprop-2-enoyl]-2-propan-2-yl-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(C)OC(=O)C1CSC(C(C)C)N1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H25NO3S/c1-13(2)18-20(16(12-24-18)19(22)23-14(3)4)17(21)11-10-15-8-6-5-7-9-15/h5-11,13-14,16,18H,12H2,1-4H3/b11-10+ |
| InChIKey | HXJIPTADPSEXPZ-ZHACJKMWSA-N |
| XLogP | 3.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|