C22H29NO3S — CID 42729782
propan-2-yl 2-cyclohexyl-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate (PubChem CID 42729782) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is propan-2-yl 2-cyclohexyl-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate.
| Compound Name | propan-2-yl 2-cyclohexyl-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 42729782 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | propan-2-yl 2-cyclohexyl-3-[(E)-3-phenylprop-2-enoyl]-1,3-thiazolidine-4-carboxylate |
| SMILES | CC(C)OC(=O)C1CSC(C2CCCCC2)N1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H29NO3S/c1-16(2)26-22(25)19-15-27-21(18-11-7-4-8-12-18)23(19)20(24)14-13-17-9-5-3-6-10-17/h3,5-6,9-10,13-14,16,18-19,21H,4,7-8,11-12,15H2,1-2H3/b14-13+ |
| InChIKey | AODAXSUYDCEHKG-BUHFOSPRSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|