C18H16Cl2N4O5S — CID 42730395
1-(4-chloro-3-nitrophenyl)sulfonyl-5-(3-chlorophenyl)-3-(2-methylpropoxy)-1,2,4-triazole (PubChem CID 42730395) has the molecular formula C18H16Cl2N4O5S and a molecular weight of 471.32 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)sulfonyl-5-(3-chlorophenyl)-3-(2-methylpropoxy)-1,2,4-triazole.
| Compound Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-5-(3-chlorophenyl)-3-(2-methylpropoxy)-1,2,4-triazole |
|---|---|
| PubChem CID | 42730395 |
| Molecular Formula | C18H16Cl2N4O5S |
| Molecular Weight | 471.32 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-5-(3-chlorophenyl)-3-(2-methylpropoxy)-1,2,4-triazole |
| SMILES | CC(C)COc1nc(-c2cccc(Cl)c2)n(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C18H16Cl2N4O5S/c1-11(2)10-29-18-21-17(12-4-3-5-13(19)8-12)23(22-18)30(27,28)14-6-7-15(20)16(9-14)24(25)26/h3-9,11H,10H2,1-2H3 |
| InChIKey | HIIOOGBXSNLLCE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|