C24H21F3N4O2 — CID 42818883
1-[(1-benzylimidazol-2-yl)methyl]-1-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 42818883) has the molecular formula C24H21F3N4O2 and a molecular weight of 454.45 g/mol. Its IUPAC name is 1-[(1-benzylimidazol-2-yl)methyl]-1-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1-benzylimidazol-2-yl)methyl]-1-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42818883 |
| Molecular Formula | C24H21F3N4O2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1-[(1-benzylimidazol-2-yl)methyl]-1-(furan-2-ylmethyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N(Cc1ccco1)Cc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C24H21F3N4O2/c25-24(26,27)19-8-10-20(11-9-19)29-23(32)31(16-21-7-4-14-33-21)17-22-28-12-13-30(22)15-18-5-2-1-3-6-18/h1-14H,15-17H2,(H,29,32) |
| InChIKey | PBMWQIKFJMVYAA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |