C14H18N2O6S — CID 42923596
(2-oxooxolan-3-yl) 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate (PubChem CID 42923596) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate.
| Compound Name | (2-oxooxolan-3-yl) 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42923596 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2-oxooxolan-3-yl) 1-methyl-4-pyrrolidin-1-ylsulfonylpyrrole-2-carboxylate |
| SMILES | Cn1cc(S(=O)(=O)N2CCCC2)cc1C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C14H18N2O6S/c1-15-9-10(23(19,20)16-5-2-3-6-16)8-11(15)13(17)22-12-4-7-21-14(12)18/h8-9,12H,2-7H2,1H3 |
| InChIKey | WZMVOFLJDLXXOT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |