C20H20N6O3 — CID 42923829
methyl 4-[(E)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethoxyiminomethyl]benzoate (PubChem CID 42923829) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is methyl 4-[(E)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethoxyiminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethoxyiminomethyl]benzoate |
|---|---|
| PubChem CID | 42923829 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | methyl 4-[(E)-1-(4-amino-6-anilino-1,3,5-triazin-2-yl)ethoxyiminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/OC(C)c2nc(N)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H20N6O3/c1-13(29-22-12-14-8-10-15(11-9-14)18(27)28-2)17-24-19(21)26-20(25-17)23-16-6-4-3-5-7-16/h3-13H,1-2H3,(H3,21,23,24,25,26)/b22-12+ |
| InChIKey | VDXZARBSKFKNOB-WSDLNYQXSA-N |
| XLogP | 3.10 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|