About (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate
(2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate (PubChem CID 42949771) has the molecular formula C18H22N2O7S2
and a molecular weight of 442.52 g/mol. Its IUPAC name is (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate |
| PubChem CID | 42949771 |
| Molecular Formula | C18H22N2O7S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate |
| SMILES | CCC(C)c1ccccc1OS(=O)(=O)c1ccc(S(=O)(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O7S2/c1-5-13(2)15-8-6-7-9-17(15)27-29(25,26)18-11-10-14(12-16(18)20(21)22)28(23,24)19(3)4/h6-13H,5H2,1-4H3 |
| InChIKey | HMLUTVGNNFHJRL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate?
The IUPAC name of (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate (CID 42949771) is (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate.
What is the SMILES notation for (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate?
The canonical SMILES for (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate is CCC(C)c1ccccc1OS(=O)(=O)c1ccc(S(=O)(=O)N(C)C)cc1[N+](=O)[O-].
What is the InChIKey of (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate?
The InChIKey is HMLUTVGNNFHJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O7S2/c1-5-13(2)15-8-6-7-9-17(15)27-29(25,26)18-11-10-14(12-16(18)20(21)22)28(23,24)19(3)4/h6-13H,5H2,1-4H3.
What are the key properties of (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate?
(2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate has a molecular weight of 442.52 g/mol, XLogP of 3.13, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butan-2-ylphenyl) 4-(dimethylsulfamoyl)-2-nitrobenzenesulfonate is sourced from PubChem (CID 42949771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).