C23H22N4O3S — CID 42997737
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide (PubChem CID 42997737) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide.
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 42997737 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(4-methyl-1,3-thiazol-2-yl)-N-phenylacetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)N(c2ccccc2)c2nc(C)cs2)C1=O |
| InChI | InChI=1S/C23H22N4O3S/c1-3-23(17-10-6-4-7-11-17)20(29)26(21(30)25-23)14-19(28)27(18-12-8-5-9-13-18)22-24-16(2)15-31-22/h4-13,15H,3,14H2,1-2H3,(H,25,30) |
| InChIKey | ADLSGACDPOAMMF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|