C22H24FN3O5 — CID 43039309
[2-amino-1-(4-fluorophenyl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 43039309) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is [2-amino-1-(4-fluorophenyl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-amino-1-(4-fluorophenyl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 43039309 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | [2-amino-1-(4-fluorophenyl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)OC(C(N)=O)c3ccc(F)cc3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C22H24FN3O5/c1-13-9-14(2)12-25(11-13)18-8-5-16(10-19(18)26(29)30)22(28)31-20(21(24)27)15-3-6-17(23)7-4-15/h3-8,10,13-14,20H,9,11-12H2,1-2H3,(H2,24,27) |
| InChIKey | RSZWEFQHXNAOJJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|