C21H33N5O4S2 — CID 43052401
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 43052401) has the molecular formula C21H33N5O4S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43052401 |
| Molecular Formula | C21H33N5O4S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(5-octyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)Cn2cc(S(=O)(=O)N(CC)CC)ccc2=O)s1 |
| InChI | InChI=1S/C21H33N5O4S2/c1-4-7-8-9-10-11-12-19-23-24-21(31-19)22-18(27)16-25-15-17(13-14-20(25)28)32(29,30)26(5-2)6-3/h13-15H,4-12,16H2,1-3H3,(H,22,24,27) |
| InChIKey | RQBZPKZYBKKEJX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|