C15H19ClN2O2 — CID 43206785
5-chloro-3-[3-(cyclopropylmethoxy)propylamino]-1,3-dihydroindol-2-one (PubChem CID 43206785) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 5-chloro-3-[3-(cyclopropylmethoxy)propylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-[3-(cyclopropylmethoxy)propylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43206785 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 5-chloro-3-[3-(cyclopropylmethoxy)propylamino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1NCCCOCC1CC1 |
| InChI | InChI=1S/C15H19ClN2O2/c16-11-4-5-13-12(8-11)14(15(19)18-13)17-6-1-7-20-9-10-2-3-10/h4-5,8,10,14,17H,1-3,6-7,9H2,(H,18,19) |
| InChIKey | CVEMXCNHZSNHID-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|