C12H14N2O2S2 — CID 43617648
methyl 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)sulfanyl]propanoate (PubChem CID 43617648) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is methyl 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)sulfanyl]propanoate.
| Compound Name | methyl 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 43617648 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | methyl 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)sulfanyl]propanoate |
| SMILES | COC(=O)CCSc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C12H14N2O2S2/c1-7-14-9-6-10(8(13)5-11(9)18-7)17-4-3-12(15)16-2/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | BYAOHKFDHHHJLN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|