C9H12N4O2 — CID 43637914
3-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]pyrrolidine-2,5-dione (PubChem CID 43637914) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]pyrrolidine-2,5-dione.
| Compound Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43637914 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-[(3,5-dimethyl-1H-pyrazol-4-yl)amino]pyrrolidine-2,5-dione |
| SMILES | Cc1n[nH]c(C)c1NC1CC(=O)NC1=O |
| InChI | InChI=1S/C9H12N4O2/c1-4-8(5(2)13-12-4)10-6-3-7(14)11-9(6)15/h6,10H,3H2,1-2H3,(H,12,13)(H,11,14,15) |
| InChIKey | SUGIIYCWMRRNCA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|