About N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine
N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 79956145) has the molecular formula C12H21N3S
and a molecular weight of 239.39 g/mol. Its IUPAC name is N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine.
Molecular Properties
| Compound Name | N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine |
| PubChem CID | 79956145 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | Cc1n[nH]c(C)c1NC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C12H21N3S/c1-8-11(9(2)15-14-8)13-10-5-12(3,4)7-16-6-10/h10,13H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | VVKNIVNTDCKBKL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine?
The IUPAC name of N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine (CID 79956145) is N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine.
What is the SMILES notation for N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine?
The canonical SMILES for N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine is Cc1n[nH]c(C)c1NC1CSCC(C)(C)C1.
What is the InChIKey of N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine?
The InChIKey is VVKNIVNTDCKBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3S/c1-8-11(9(2)15-14-8)13-10-5-12(3,4)7-16-6-10/h10,13H,5-7H2,1-4H3,(H,14,15).
What are the key properties of N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine?
N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine has a molecular weight of 239.39 g/mol, XLogP of 2.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-dimethylthian-3-yl)-3,5-dimethyl-1H-pyrazol-4-amine is sourced from PubChem (CID 79956145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).