C12H14ClN3O3S2 — CID 43699874
2-amino-N-(5-chloro-1,3-benzothiazol-4-yl)-4-methylsulfonylbutanamide (PubChem CID 43699874) has the molecular formula C12H14ClN3O3S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 2-amino-N-(5-chloro-1,3-benzothiazol-4-yl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(5-chloro-1,3-benzothiazol-4-yl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43699874 |
| Molecular Formula | C12H14ClN3O3S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-amino-N-(5-chloro-1,3-benzothiazol-4-yl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1c(Cl)ccc2scnc12 |
| InChI | InChI=1S/C12H14ClN3O3S2/c1-21(18,19)5-4-8(14)12(17)16-10-7(13)2-3-9-11(10)15-6-20-9/h2-3,6,8H,4-5,14H2,1H3,(H,16,17) |
| InChIKey | JBNQLDZAUFGSSF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |