C16H22O7S2 — CID 44521431
[(3aR,5S,6S,6aR)-2,2-dimethyl-5-[(5Z,10R)-2-oxo-4,7,9,10-tetrahydro-1,3,8-oxadithiecin-10-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate (PubChem CID 44521431) has the molecular formula C16H22O7S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(3aR,5S,6S,6aR)-2,2-dimethyl-5-[(5Z,10R)-2-oxo-4,7,9,10-tetrahydro-1,3,8-oxadithiecin-10-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,5S,6S,6aR)-2,2-dimethyl-5-[(5Z,10R)-2-oxo-4,7,9,10-tetrahydro-1,3,8-oxadithiecin-10-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 44521431 |
| Molecular Formula | C16H22O7S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | [(3aR,5S,6S,6aR)-2,2-dimethyl-5-[(5Z,10R)-2-oxo-4,7,9,10-tetrahydro-1,3,8-oxadithiecin-10-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H]1CSC/C=C\CSC(=O)O1 |
| InChI | InChI=1S/C16H22O7S2/c1-9(17)19-12-11(21-14-13(12)22-16(2,3)23-14)10-8-24-6-4-5-7-25-15(18)20-10/h4-5,10-14H,6-8H2,1-3H3/b5-4-/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | RSSKZZCECXCZMA-CSALQAEFSA-N |
| XLogP | 2.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|