C26H38Cl2N4O2 — CID 44529131
(E)-N-[5-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 44529131) has the molecular formula C26H38Cl2N4O2 and a molecular weight of 509.52 g/mol. Its IUPAC name is (E)-N-[5-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44529131 |
| Molecular Formula | C26H38Cl2N4O2 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (E)-N-[5-[4-(cyclohexylcarbamoylamino)piperidin-1-yl]pentyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C26H38Cl2N4O2/c27-23-11-9-20(19-24(23)28)10-12-25(33)29-15-5-2-6-16-32-17-13-22(14-18-32)31-26(34)30-21-7-3-1-4-8-21/h9-12,19,21-22H,1-8,13-18H2,(H,29,33)(H2,30,31,34)/b12-10+ |
| InChIKey | PCDAUNNOONGPHS-ZRDIBKRKSA-N |
| XLogP | 5.39 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|