C26H31N5O10 — CID 44542889
N-[4-[(2,3-dihydroxybenzoyl)amino]-5-[[2-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-2-oxoethyl]amino]-5-oxopentyl]-2,3-dihydroxybenzamide (PubChem CID 44542889) has the molecular formula C26H31N5O10 and a molecular weight of 573.56 g/mol. Its IUPAC name is N-[4-[(2,3-dihydroxybenzoyl)amino]-5-[[2-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-2-oxoethyl]amino]-5-oxopentyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[4-[(2,3-dihydroxybenzoyl)amino]-5-[[2-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-2-oxoethyl]amino]-5-oxopentyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 44542889 |
| Molecular Formula | C26H31N5O10 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | N-[4-[(2,3-dihydroxybenzoyl)amino]-5-[[2-[(1-hydroxy-2-oxopiperidin-3-yl)amino]-2-oxoethyl]amino]-5-oxopentyl]-2,3-dihydroxybenzamide |
| SMILES | O=C(CNC(=O)C(CCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O)NC1CCCN(O)C1=O |
| InChI | InChI=1S/C26H31N5O10/c32-18-9-1-5-14(21(18)35)23(37)27-11-3-7-16(30-24(38)15-6-2-10-19(33)22(15)36)25(39)28-13-20(34)29-17-8-4-12-31(41)26(17)40/h1-2,5-6,9-10,16-17,32-33,35-36,41H,3-4,7-8,11-13H2,(H,27,37)(H,28,39)(H,29,34)(H,30,38) |
| InChIKey | ILQHJVIKARFYJO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 237.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|