C20H20ClN5O4 — CID 44544373
1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(2-methoxy-4-nitrophenyl)urea (PubChem CID 44544373) has the molecular formula C20H20ClN5O4 and a molecular weight of 429.86 g/mol. Its IUPAC name is 1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(2-methoxy-4-nitrophenyl)urea.
| Compound Name | 1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(2-methoxy-4-nitrophenyl)urea |
|---|---|
| PubChem CID | 44544373 |
| Molecular Formula | C20H20ClN5O4 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-[3-[(7-chloroquinolin-4-yl)amino]propyl]-3-(2-methoxy-4-nitrophenyl)urea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)NCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H20ClN5O4/c1-30-19-12-14(26(28)29)4-6-17(19)25-20(27)24-9-2-8-22-16-7-10-23-18-11-13(21)3-5-15(16)18/h3-7,10-12H,2,8-9H2,1H3,(H,22,23)(H2,24,25,27) |
| InChIKey | RDEFCMFVCFFIFR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|