C17H18ClN5O2S2 — CID 44544995
6-chloro-N-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 44544995) has the molecular formula C17H18ClN5O2S2 and a molecular weight of 423.95 g/mol. Its IUPAC name is 6-chloro-N-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-chloro-N-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 44544995 |
| Molecular Formula | C17H18ClN5O2S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 6-chloro-N-(2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-yl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CN1CCc2c([nH]c3ccc(NS(=O)(=O)c4c(Cl)nc5n4CCS5)cc23)C1 |
| InChI | InChI=1S/C17H18ClN5O2S2/c1-22-5-4-11-12-8-10(2-3-13(12)19-14(11)9-22)21-27(24,25)16-15(18)20-17-23(16)6-7-26-17/h2-3,8,19,21H,4-7,9H2,1H3 |
| InChIKey | MWQLQFCJNUQSFW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|