C19H27NS — CID 44556711
(4S,6R)-4-tert-butyl-6-phenyl-1-azabicyclo[4.3.1]decane-10-thione (PubChem CID 44556711) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is (4S,6R)-4-tert-butyl-6-phenyl-1-azabicyclo[4.3.1]decane-10-thione.
| Compound Name | (4S,6R)-4-tert-butyl-6-phenyl-1-azabicyclo[4.3.1]decane-10-thione |
|---|---|
| PubChem CID | 44556711 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | (4S,6R)-4-tert-butyl-6-phenyl-1-azabicyclo[4.3.1]decane-10-thione |
| SMILES | CC(C)(C)[C@@H]1CCN2CCC[C@](c3ccccc3)(C1)C2=S |
| InChI | InChI=1S/C19H27NS/c1-18(2,3)16-10-13-20-12-7-11-19(14-16,17(20)21)15-8-5-4-6-9-15/h4-6,8-9,16H,7,10-14H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | MPBQIAFPAYFRME-VQIMIIECSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|