C21H31NO — CID 102483762
(4R,6R,10R)-4-tert-butyl-6-phenylspiro[bicyclo[4.3.1]decane-10,2'-oxirane]-1-amine (PubChem CID 102483762) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (4R,6R,10R)-4-tert-butyl-6-phenylspiro[bicyclo[4.3.1]decane-10,2'-oxirane]-1-amine.
| Compound Name | (4R,6R,10R)-4-tert-butyl-6-phenylspiro[bicyclo[4.3.1]decane-10,2'-oxirane]-1-amine |
|---|---|
| PubChem CID | 102483762 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (4R,6R,10R)-4-tert-butyl-6-phenylspiro[bicyclo[4.3.1]decane-10,2'-oxirane]-1-amine |
| SMILES | CC(C)(C)[C@@H]1CCC2(N)CCC[C@](c3ccccc3)(C1)[C@]21CO1 |
| InChI | InChI=1S/C21H31NO/c1-18(2,3)17-10-13-20(22)12-7-11-19(14-17,21(20)15-23-21)16-8-5-4-6-9-16/h4-6,8-9,17H,7,10-15,22H2,1-3H3/t17-,19-,20?,21-/m1/s1 |
| InChIKey | GLVCXADLWOUFRL-QKNTZHCYSA-N |
| XLogP | 4.42 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|