C17H12F17NO3 — CID 44557590
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl 2,5-dimethyl-1,3-oxazole-4-carboxylate (PubChem CID 44557590) has the molecular formula C17H12F17NO3 and a molecular weight of 601.25 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl 2,5-dimethyl-1,3-oxazole-4-carboxylate.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl 2,5-dimethyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 44557590 |
| Molecular Formula | C17H12F17NO3 |
| Molecular Weight | 601.25 g/mol |
| Exact Mass | 601.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl 2,5-dimethyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1nc(C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(C)o1 |
| InChI | InChI=1S/C17H12F17NO3/c1-6-8(35-7(2)38-6)9(36)37-5-3-4-10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h3-5H2,1-2H3 |
| InChIKey | PSOJOAKACVOREZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.25 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|