C16H12Cl3NO4 — CID 44576958
[5-chloro-2-(2,4-dichlorophenoxy)phenyl] 4-amino-4-oxobutanoate (PubChem CID 44576958) has the molecular formula C16H12Cl3NO4 and a molecular weight of 388.63 g/mol. Its IUPAC name is [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 4-amino-4-oxobutanoate.
| Compound Name | [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 4-amino-4-oxobutanoate |
|---|---|
| PubChem CID | 44576958 |
| Molecular Formula | C16H12Cl3NO4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 4-amino-4-oxobutanoate |
| SMILES | NC(=O)CCC(=O)Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3NO4/c17-9-1-3-12(11(19)7-9)23-13-4-2-10(18)8-14(13)24-16(22)6-5-15(20)21/h1-4,7-8H,5-6H2,(H2,20,21) |
| InChIKey | XGQWLKAWFZWHFN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|