C19H16Cl4O4 — CID 88685334
[5-chloro-2-(2,4-dichlorophenoxy)phenyl] 5-chloro-2,2-dimethyl-5-oxopentanoate (PubChem CID 88685334) has the molecular formula C19H16Cl4O4 and a molecular weight of 450.15 g/mol. Its IUPAC name is [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 5-chloro-2,2-dimethyl-5-oxopentanoate.
| Compound Name | [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 5-chloro-2,2-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 88685334 |
| Molecular Formula | C19H16Cl4O4 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 5-chloro-2,2-dimethyl-5-oxopentanoate |
| SMILES | CC(C)(CCC(=O)Cl)C(=O)Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl4O4/c1-19(2,8-7-17(23)24)18(25)27-16-10-12(21)4-6-15(16)26-14-5-3-11(20)9-13(14)22/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | CXIFUXZMHOFILZ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|