C12H16O5 — CID 44596940
methyl (1R,3R,6S,7S,8S,10R)-10-hydroxy-1,6-dimethyl-2,9-dioxatricyclo[5.2.1.03,8]dec-4-ene-7-carboxylate (PubChem CID 44596940) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is methyl (1R,3R,6S,7S,8S,10R)-10-hydroxy-1,6-dimethyl-2,9-dioxatricyclo[5.2.1.03,8]dec-4-ene-7-carboxylate.
| Compound Name | methyl (1R,3R,6S,7S,8S,10R)-10-hydroxy-1,6-dimethyl-2,9-dioxatricyclo[5.2.1.03,8]dec-4-ene-7-carboxylate |
|---|---|
| PubChem CID | 44596940 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | methyl (1R,3R,6S,7S,8S,10R)-10-hydroxy-1,6-dimethyl-2,9-dioxatricyclo[5.2.1.03,8]dec-4-ene-7-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H]3OC(C)(O[C@@H]3C=C[C@@H]1C)[C@@H]2O |
| InChI | InChI=1S/C12H16O5/c1-6-4-5-7-8-12(6,10(14)15-3)9(13)11(2,16-7)17-8/h4-9,13H,1-3H3/t6-,7+,8+,9-,11?,12+/m0/s1 |
| InChIKey | CMKNRAGJXTXODZ-PMKMNUDMSA-N |
| XLogP | 0.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|