C22H8N4S — CID 44597819
2-[[9-(2,2-dicyanoethenyl)acenaphthyleno[1,2-c]thiophen-7-yl]methylidene]propanedinitrile (PubChem CID 44597819) has the molecular formula C22H8N4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-[[9-(2,2-dicyanoethenyl)acenaphthyleno[1,2-c]thiophen-7-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[9-(2,2-dicyanoethenyl)acenaphthyleno[1,2-c]thiophen-7-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 44597819 |
| Molecular Formula | C22H8N4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-[[9-(2,2-dicyanoethenyl)acenaphthyleno[1,2-c]thiophen-7-yl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1sc(C=C(C#N)C#N)c2c1-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C22H8N4S/c23-9-13(10-24)7-18-21-16-5-1-3-15-4-2-6-17(20(15)16)22(21)19(27-18)8-14(11-25)12-26/h1-8H |
| InChIKey | SNXPNUYVZLZDIB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|