C24H26N2O6 — CID 44628394
2-[1-[cyclohex-2-en-1-yl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 1H-indole-5-carboxylate (PubChem CID 44628394) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[1-[cyclohex-2-en-1-yl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 1H-indole-5-carboxylate.
| Compound Name | 2-[1-[cyclohex-2-en-1-yl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 44628394 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[1-[cyclohex-2-en-1-yl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 1H-indole-5-carboxylate |
| SMILES | CC12OC(=O)C1(C(O)C1C=CCCC1)NC(=O)C2CCOC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C24H26N2O6/c1-23-17(10-12-31-21(29)16-7-8-18-15(13-16)9-11-25-18)20(28)26-24(23,22(30)32-23)19(27)14-5-3-2-4-6-14/h3,5,7-9,11,13-14,17,19,25,27H,2,4,6,10,12H2,1H3,(H,26,28) |
| InChIKey | QEBVYSJEMBQOME-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|