About tetramethylazanium;trifluoromethanolate
tetramethylazanium;trifluoromethanolate (PubChem CID 44630782) has the molecular formula C5H12F3NO
and a molecular weight of 159.15 g/mol. Its IUPAC name is tetramethylazanium;trifluoromethanolate.
Molecular Properties
| Compound Name | tetramethylazanium;trifluoromethanolate |
| PubChem CID | 44630782 |
| Molecular Formula | C5H12F3NO |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | tetramethylazanium;trifluoromethanolate |
| SMILES | C[N+](C)(C)C.[O-]C(F)(F)F |
| InChI | InChI=1S/C4H12N.CF3O/c1-5(2,3)4;2-1(3,4)5/h1-4H3;/q+1;-1 |
| InChIKey | RXOIVYZLFDYMDS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetramethylazanium;trifluoromethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetramethylazanium;trifluoromethanolate?
The IUPAC name of tetramethylazanium;trifluoromethanolate (CID 44630782) is tetramethylazanium;trifluoromethanolate.
What is the SMILES notation for tetramethylazanium;trifluoromethanolate?
The canonical SMILES for tetramethylazanium;trifluoromethanolate is C[N+](C)(C)C.[O-]C(F)(F)F.
What is the InChIKey of tetramethylazanium;trifluoromethanolate?
The InChIKey is RXOIVYZLFDYMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N.CF3O/c1-5(2,3)4;2-1(3,4)5/h1-4H3;/q+1;-1.
What are the key properties of tetramethylazanium;trifluoromethanolate?
tetramethylazanium;trifluoromethanolate has a molecular weight of 159.15 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethylazanium;trifluoromethanolate is sourced from PubChem (CID 44630782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).