C18H34N2O — CID 44756928
(2E)-N-[2-[di(propan-2-yl)amino]ethyl]-3,7-dimethylocta-2,6-dienamide (PubChem CID 44756928) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is (2E)-N-[2-[di(propan-2-yl)amino]ethyl]-3,7-dimethylocta-2,6-dienamide.
| Compound Name | (2E)-N-[2-[di(propan-2-yl)amino]ethyl]-3,7-dimethylocta-2,6-dienamide |
|---|---|
| PubChem CID | 44756928 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | (2E)-N-[2-[di(propan-2-yl)amino]ethyl]-3,7-dimethylocta-2,6-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34N2O/c1-14(2)9-8-10-17(7)13-18(21)19-11-12-20(15(3)4)16(5)6/h9,13,15-16H,8,10-12H2,1-7H3,(H,19,21)/b17-13+ |
| InChIKey | LVNLEHMLCIYXDN-GHRIWEEISA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|