C26H27ClN2O3 — CID 4502468
9-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 4502468) has the molecular formula C26H27ClN2O3 and a molecular weight of 450.97 g/mol. Its IUPAC name is 9-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 4502468 |
| Molecular Formula | C26H27ClN2O3 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 9-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27ClN2O3/c1-25(2)9-17(30)22-19(11-25)32-20-12-26(3,4)10-18(31)23(20)21(22)16-13-28-29-24(16)14-5-7-15(27)8-6-14/h5-8,13,21H,9-12H2,1-4H3,(H,28,29) |
| InChIKey | POANNVAKCGNANT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |